C17H17FN4O2S — CID 10383914
3-(benzenesulfonyl)-7-fluoro-5-piperazin-1-yl-1H-pyrrolo[2,3-c]pyridine (PubChem CID 10383914) has the molecular formula C17H17FN4O2S and a molecular weight of 360.41 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-7-fluoro-5-piperazin-1-yl-1H-pyrrolo[2,3-c]pyridine.
| Compound Name | 3-(benzenesulfonyl)-7-fluoro-5-piperazin-1-yl-1H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 10383914 |
| Molecular Formula | C17H17FN4O2S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3-(benzenesulfonyl)-7-fluoro-5-piperazin-1-yl-1H-pyrrolo[2,3-c]pyridine |
| SMILES | O=S(=O)(c1ccccc1)c1c[nH]c2c(F)nc(N3CCNCC3)cc12 |
| InChI | InChI=1S/C17H17FN4O2S/c18-17-16-13(10-15(21-17)22-8-6-19-7-9-22)14(11-20-16)25(23,24)12-4-2-1-3-5-12/h1-5,10-11,19-20H,6-9H2 |
| InChIKey | RZFRILJJOWCPAC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|