C17H20FN4O6PS — CID 68717491
7-(3-fluorophenyl)sulfonyl-3-piperazin-1-yl-1H-pyrrolo[3,2-b]pyridine;phosphoric acid (PubChem CID 68717491) has the molecular formula C17H20FN4O6PS and a molecular weight of 458.41 g/mol. Its IUPAC name is 7-(3-fluorophenyl)sulfonyl-3-piperazin-1-yl-1H-pyrrolo[3,2-b]pyridine;phosphoric acid.
| Compound Name | 7-(3-fluorophenyl)sulfonyl-3-piperazin-1-yl-1H-pyrrolo[3,2-b]pyridine;phosphoric acid |
|---|---|
| PubChem CID | 68717491 |
| Molecular Formula | C17H20FN4O6PS |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | 7-(3-fluorophenyl)sulfonyl-3-piperazin-1-yl-1H-pyrrolo[3,2-b]pyridine;phosphoric acid |
| SMILES | O=P(O)(O)O.O=S(=O)(c1cccc(F)c1)c1ccnc2c(N3CCNCC3)c[nH]c12 |
| InChI | InChI=1S/C17H17FN4O2S.H3O4P/c18-12-2-1-3-13(10-12)25(23,24)15-4-5-20-16-14(11-21-17(15)16)22-8-6-19-7-9-22;1-5(2,3)4/h1-5,10-11,19,21H,6-9H2;(H3,1,2,3,4) |
| InChIKey | LHSXYOIDLPOEKB-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 155.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|