C15H20BrClN2O — CID 103841606
3-bromo-4-chloro-N-(1-ethylpiperidin-4-yl)-N-methylbenzamide (PubChem CID 103841606) has the molecular formula C15H20BrClN2O and a molecular weight of 359.70 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-(1-ethylpiperidin-4-yl)-N-methylbenzamide.
| Compound Name | 3-bromo-4-chloro-N-(1-ethylpiperidin-4-yl)-N-methylbenzamide |
|---|---|
| PubChem CID | 103841606 |
| Molecular Formula | C15H20BrClN2O |
| Molecular Weight | 359.70 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 3-bromo-4-chloro-N-(1-ethylpiperidin-4-yl)-N-methylbenzamide |
| SMILES | CCN1CCC(N(C)C(=O)c2ccc(Cl)c(Br)c2)CC1 |
| InChI | InChI=1S/C15H20BrClN2O/c1-3-19-8-6-12(7-9-19)18(2)15(20)11-4-5-14(17)13(16)10-11/h4-5,10,12H,3,6-9H2,1-2H3 |
| InChIKey | SVCDPAIMUWRVOY-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.70 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |