C14H19Cl2N3O — CID 106993273
2,6-dichloro-N-(1-ethylpiperidin-4-yl)-N-methylpyridine-3-carboxamide (PubChem CID 106993273) has the molecular formula C14H19Cl2N3O and a molecular weight of 316.23 g/mol. Its IUPAC name is 2,6-dichloro-N-(1-ethylpiperidin-4-yl)-N-methylpyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-(1-ethylpiperidin-4-yl)-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 106993273 |
| Molecular Formula | C14H19Cl2N3O |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | 2,6-dichloro-N-(1-ethylpiperidin-4-yl)-N-methylpyridine-3-carboxamide |
| SMILES | CCN1CCC(N(C)C(=O)c2ccc(Cl)nc2Cl)CC1 |
| InChI | InChI=1S/C14H19Cl2N3O/c1-3-19-8-6-10(7-9-19)18(2)14(20)11-4-5-12(15)17-13(11)16/h4-5,10H,3,6-9H2,1-2H3 |
| InChIKey | JNUFMPODHHZFKT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|