C15H17BrClNO — CID 103841864
2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(3-bromo-4-chlorophenyl)methanone (PubChem CID 103841864) has the molecular formula C15H17BrClNO and a molecular weight of 342.66 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(3-bromo-4-chlorophenyl)methanone.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(3-bromo-4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 103841864 |
| Molecular Formula | C15H17BrClNO |
| Molecular Weight | 342.66 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydroindol-1-yl-(3-bromo-4-chlorophenyl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Br)c1)N1CCC2CCCCC21 |
| InChI | InChI=1S/C15H17BrClNO/c16-12-9-11(5-6-13(12)17)15(19)18-8-7-10-3-1-2-4-14(10)18/h5-6,9-10,14H,1-4,7-8H2 |
| InChIKey | DWFIDOWMLOVANM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |