C17H21BrClNO — CID 107999426
(3-bromo-4-chlorophenyl)-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone (PubChem CID 107999426) has the molecular formula C17H21BrClNO and a molecular weight of 370.72 g/mol. Its IUPAC name is (3-bromo-4-chlorophenyl)-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone.
| Compound Name | (3-bromo-4-chlorophenyl)-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone |
|---|---|
| PubChem CID | 107999426 |
| Molecular Formula | C17H21BrClNO |
| Molecular Weight | 370.72 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | (3-bromo-4-chlorophenyl)-(4-methyl-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc(Cl)c(Br)c2)C2CCCCC12 |
| InChI | InChI=1S/C17H21BrClNO/c1-11-8-9-20(16-5-3-2-4-13(11)16)17(21)12-6-7-15(19)14(18)10-12/h6-7,10-11,13,16H,2-5,8-9H2,1H3 |
| InChIKey | VBCCWOPKWCEKBN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.72 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |