C9H17N3 — CID 103842901
1-[2-(cyclopenten-1-yl)ethyl]-2-methylguanidine (PubChem CID 103842901) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 1-[2-(cyclopenten-1-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(cyclopenten-1-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 103842901 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1-[2-(cyclopenten-1-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\N)NCCC1=CCCC1 |
| InChI | InChI=1S/C9H17N3/c1-11-9(10)12-7-6-8-4-2-3-5-8/h4H,2-3,5-7H2,1H3,(H3,10,11,12) |
| InChIKey | JDKIDUDMASGZNO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|