C11H21N3 — CID 103842915
1-[2-(cyclopenten-1-yl)ethyl]-2-propylguanidine (PubChem CID 103842915) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-[2-(cyclopenten-1-yl)ethyl]-2-propylguanidine.
| Compound Name | 1-[2-(cyclopenten-1-yl)ethyl]-2-propylguanidine |
|---|---|
| PubChem CID | 103842915 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-[2-(cyclopenten-1-yl)ethyl]-2-propylguanidine |
| SMILES | CCC/N=C(\N)NCCC1=CCCC1 |
| InChI | InChI=1S/C11H21N3/c1-2-8-13-11(12)14-9-7-10-5-3-4-6-10/h5H,2-4,6-9H2,1H3,(H3,12,13,14) |
| InChIKey | PKGMVMPCWAQUAX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|