C16H23N3O3S — CID 103845450
tert-butyl (4S)-3-[(4-cyanothiophen-2-yl)methylamino]-4-methoxypyrrolidine-1-carboxylate (PubChem CID 103845450) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is tert-butyl (4S)-3-[(4-cyanothiophen-2-yl)methylamino]-4-methoxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-3-[(4-cyanothiophen-2-yl)methylamino]-4-methoxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 103845450 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | tert-butyl (4S)-3-[(4-cyanothiophen-2-yl)methylamino]-4-methoxypyrrolidine-1-carboxylate |
| SMILES | CO[C@H]1CN(C(=O)OC(C)(C)C)CC1NCc1cc(C#N)cs1 |
| InChI | InChI=1S/C16H23N3O3S/c1-16(2,3)22-15(20)19-8-13(14(9-19)21-4)18-7-12-5-11(6-17)10-23-12/h5,10,13-14,18H,7-9H2,1-4H3/t13?,14-/m0/s1 |
| InChIKey | PVABFXYZHBYYOC-KZUDCZAMSA-N |
| XLogP | 2.34 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |