C17H17BrN2O — CID 103846407
3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]-N-methylbenzamide (PubChem CID 103846407) has the molecular formula C17H17BrN2O and a molecular weight of 345.24 g/mol. Its IUPAC name is 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]-N-methylbenzamide.
| Compound Name | 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 103846407 |
| Molecular Formula | C17H17BrN2O |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 3-[(4-bromo-2,3-dihydro-1H-inden-1-yl)amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1cccc(NC2CCc3c(Br)cccc32)c1 |
| InChI | InChI=1S/C17H17BrN2O/c1-19-17(21)11-4-2-5-12(10-11)20-16-9-8-13-14(16)6-3-7-15(13)18/h2-7,10,16,20H,8-9H2,1H3,(H,19,21) |
| InChIKey | IESYAIBEWVUCCN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |