C9H8Br2F3N — CID 103846559
1-(3,4-dibromophenyl)-3,3,3-trifluoropropan-1-amine (PubChem CID 103846559) has the molecular formula C9H8Br2F3N and a molecular weight of 346.97 g/mol. Its IUPAC name is 1-(3,4-dibromophenyl)-3,3,3-trifluoropropan-1-amine.
| Compound Name | 1-(3,4-dibromophenyl)-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 103846559 |
| Molecular Formula | C9H8Br2F3N |
| Molecular Weight | 346.97 g/mol |
| Exact Mass | 344.90 |
| IUPAC Name | 1-(3,4-dibromophenyl)-3,3,3-trifluoropropan-1-amine |
| SMILES | NC(CC(F)(F)F)c1ccc(Br)c(Br)c1 |
| InChI | InChI=1S/C9H8Br2F3N/c10-6-2-1-5(3-7(6)11)8(15)4-9(12,13)14/h1-3,8H,4,15H2 |
| InChIKey | YXBDYZOSKLIADB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.97 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |