C11H12N2OS — CID 103846679
2-(2-methyloxolan-3-yl)sulfanylpyridine-3-carbonitrile (PubChem CID 103846679) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is 2-(2-methyloxolan-3-yl)sulfanylpyridine-3-carbonitrile.
| Compound Name | 2-(2-methyloxolan-3-yl)sulfanylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 103846679 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-(2-methyloxolan-3-yl)sulfanylpyridine-3-carbonitrile |
| SMILES | CC1OCCC1Sc1ncccc1C#N |
| InChI | InChI=1S/C11H12N2OS/c1-8-10(4-6-14-8)15-11-9(7-12)3-2-5-13-11/h2-3,5,8,10H,4,6H2,1H3 |
| InChIKey | XVQXOQPYHZJNRH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |