C13H12F3NOS — CID 107749260
5-(2-methyloxolan-3-yl)sulfanyl-2-(trifluoromethyl)benzonitrile (PubChem CID 107749260) has the molecular formula C13H12F3NOS and a molecular weight of 287.31 g/mol. Its IUPAC name is 5-(2-methyloxolan-3-yl)sulfanyl-2-(trifluoromethyl)benzonitrile.
| Compound Name | 5-(2-methyloxolan-3-yl)sulfanyl-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 107749260 |
| Molecular Formula | C13H12F3NOS |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 5-(2-methyloxolan-3-yl)sulfanyl-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1OCCC1Sc1ccc(C(F)(F)F)c(C#N)c1 |
| InChI | InChI=1S/C13H12F3NOS/c1-8-12(4-5-18-8)19-10-2-3-11(13(14,15)16)9(6-10)7-17/h2-3,6,8,12H,4-5H2,1H3 |
| InChIKey | WZDDAPBONXXSMH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |