C16H30N4O2 — CID 103846730
tert-butyl N-[2-[(1-ethylimidazol-2-yl)methylamino]ethyl]-N-propylcarbamate (PubChem CID 103846730) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is tert-butyl N-[2-[(1-ethylimidazol-2-yl)methylamino]ethyl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[2-[(1-ethylimidazol-2-yl)methylamino]ethyl]-N-propylcarbamate |
|---|---|
| PubChem CID | 103846730 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | tert-butyl N-[2-[(1-ethylimidazol-2-yl)methylamino]ethyl]-N-propylcarbamate |
| SMILES | CCCN(CCNCc1nccn1CC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N4O2/c1-6-10-20(15(21)22-16(3,4)5)11-8-17-13-14-18-9-12-19(14)7-2/h9,12,17H,6-8,10-11,13H2,1-5H3 |
| InChIKey | RJMWPMRYDBBTKC-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|