C16H30N4O2 — CID 107246928
tert-butyl N-[4-[(1-propylimidazol-2-yl)methylamino]butan-2-yl]carbamate (PubChem CID 107246928) has the molecular formula C16H30N4O2 and a molecular weight of 310.44 g/mol. Its IUPAC name is tert-butyl N-[4-[(1-propylimidazol-2-yl)methylamino]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(1-propylimidazol-2-yl)methylamino]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 107246928 |
| Molecular Formula | C16H30N4O2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | tert-butyl N-[4-[(1-propylimidazol-2-yl)methylamino]butan-2-yl]carbamate |
| SMILES | CCCn1ccnc1CNCCC(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H30N4O2/c1-6-10-20-11-9-18-14(20)12-17-8-7-13(2)19-15(21)22-16(3,4)5/h9,11,13,17H,6-8,10,12H2,1-5H3,(H,19,21) |
| InChIKey | FRNUGTCNIAOBFL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|