C17H21ClO5S — CID 10384692
(1S,6R,9S,12R)-12-(4-chlorophenyl)sulfonyl-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane (PubChem CID 10384692) has the molecular formula C17H21ClO5S and a molecular weight of 372.87 g/mol. Its IUPAC name is (1S,6R,9S,12R)-12-(4-chlorophenyl)sulfonyl-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane.
| Compound Name | (1S,6R,9S,12R)-12-(4-chlorophenyl)sulfonyl-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane |
|---|---|
| PubChem CID | 10384692 |
| Molecular Formula | C17H21ClO5S |
| Molecular Weight | 372.87 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (1S,6R,9S,12R)-12-(4-chlorophenyl)sulfonyl-9-methyl-10,11,13-trioxatricyclo[7.2.2.01,6]tridecane |
| SMILES | C[C@@]12CC[C@H]3CCCC[C@@]3(OO1)[C@@H](S(=O)(=O)c1ccc(Cl)cc1)O2 |
| InChI | InChI=1S/C17H21ClO5S/c1-16-11-9-12-4-2-3-10-17(12,23-22-16)15(21-16)24(19,20)14-7-5-13(18)6-8-14/h5-8,12,15H,2-4,9-11H2,1H3/t12-,15-,16+,17+/m1/s1 |
| InChIKey | JRGWNBXEXSDGEC-VZEFYGNVSA-N |
| XLogP | 3.86 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|