propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate

C10H18O3S — CID 103847391

IUPACpropan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate
SMILESCC(C)OC(=O)CSC1CCOC1C
InChIInChI=1S/C10H18O3S/c1-7(2)13-10(11)6-14-9-4-5-12-8(9)3/h7-9H,4-6H2,1-3H3
InChIKeyNNXCRCJFLZETAF-UHFFFAOYSA-N
MW218.32 g/mol
LogP1.85
Rot. Bonds4

About propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate

propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate (PubChem CID 103847391) has the molecular formula C10H18O3S and a molecular weight of 218.32 g/mol. Its IUPAC name is propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate.

Molecular Properties

Compound Namepropan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate
PubChem CID103847391
Molecular FormulaC10H18O3S
Molecular Weight218.32 g/mol
Exact Mass218.10
IUPAC Namepropan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate
SMILESCC(C)OC(=O)CSC1CCOC1C
InChIInChI=1S/C10H18O3S/c1-7(2)13-10(11)6-14-9-4-5-12-8(9)3/h7-9H,4-6H2,1-3H3
InChIKeyNNXCRCJFLZETAF-UHFFFAOYSA-N
XLogP1.85
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.32
LogP ≤ 51.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate?
The IUPAC name of propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate (CID 103847391) is propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate.
What is the SMILES notation for propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate?
The canonical SMILES for propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate is CC(C)OC(=O)CSC1CCOC1C.
What is the InChIKey of propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate?
The InChIKey is NNXCRCJFLZETAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3S/c1-7(2)13-10(11)6-14-9-4-5-12-8(9)3/h7-9H,4-6H2,1-3H3.
What are the key properties of propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate?
propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate has a molecular weight of 218.32 g/mol, XLogP of 1.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-(2-methyloxolan-3-yl)sulfanylacetate is sourced from PubChem (CID 103847391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).