C8H14N2O2S2 — CID 103847837
N-tert-butyl-2-methyl-1,3-thiazole-5-sulfonamide (PubChem CID 103847837) has the molecular formula C8H14N2O2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is N-tert-butyl-2-methyl-1,3-thiazole-5-sulfonamide.
| Compound Name | N-tert-butyl-2-methyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 103847837 |
| Molecular Formula | C8H14N2O2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | N-tert-butyl-2-methyl-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)NC(C)(C)C)s1 |
| InChI | InChI=1S/C8H14N2O2S2/c1-6-9-5-7(13-6)14(11,12)10-8(2,3)4/h5,10H,1-4H3 |
| InChIKey | HDQJQASDRYWXAJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |