C7H13N3O2S2 — CID 87417112
2-amino-N-tert-butyl-1,3-thiazole-5-sulfonamide (PubChem CID 87417112) has the molecular formula C7H13N3O2S2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-amino-N-tert-butyl-1,3-thiazole-5-sulfonamide.
| Compound Name | 2-amino-N-tert-butyl-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 87417112 |
| Molecular Formula | C7H13N3O2S2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 2-amino-N-tert-butyl-1,3-thiazole-5-sulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1cnc(N)s1 |
| InChI | InChI=1S/C7H13N3O2S2/c1-7(2,3)10-14(11,12)5-4-9-6(8)13-5/h4,10H,1-3H3,(H2,8,9) |
| InChIKey | FUBPTCCBHCUOFZ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |