C10H17N3O2 — CID 103848451
3-[[(3-methylimidazol-4-yl)methylamino]methyl]oxolan-3-ol (PubChem CID 103848451) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-[[(3-methylimidazol-4-yl)methylamino]methyl]oxolan-3-ol.
| Compound Name | 3-[[(3-methylimidazol-4-yl)methylamino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 103848451 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-[[(3-methylimidazol-4-yl)methylamino]methyl]oxolan-3-ol |
| SMILES | Cn1cncc1CNCC1(O)CCOC1 |
| InChI | InChI=1S/C10H17N3O2/c1-13-8-12-5-9(13)4-11-6-10(14)2-3-15-7-10/h5,8,11,14H,2-4,6-7H2,1H3 |
| InChIKey | QWQVXGKBSNIADQ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |