C12H15F2NO2 — CID 113338500
3-[[(3,5-difluorophenyl)methylamino]methyl]oxolan-3-ol (PubChem CID 113338500) has the molecular formula C12H15F2NO2 and a molecular weight of 243.25 g/mol. Its IUPAC name is 3-[[(3,5-difluorophenyl)methylamino]methyl]oxolan-3-ol.
| Compound Name | 3-[[(3,5-difluorophenyl)methylamino]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 113338500 |
| Molecular Formula | C12H15F2NO2 |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 3-[[(3,5-difluorophenyl)methylamino]methyl]oxolan-3-ol |
| SMILES | OC1(CNCc2cc(F)cc(F)c2)CCOC1 |
| InChI | InChI=1S/C12H15F2NO2/c13-10-3-9(4-11(14)5-10)6-15-7-12(16)1-2-17-8-12/h3-5,15-16H,1-2,6-8H2 |
| InChIKey | SIZFSFPYYBSTNK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |