C12H17NO4 — CID 113337838
4-[[(3-hydroxyoxolan-3-yl)methylamino]methyl]benzene-1,3-diol (PubChem CID 113337838) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is 4-[[(3-hydroxyoxolan-3-yl)methylamino]methyl]benzene-1,3-diol.
| Compound Name | 4-[[(3-hydroxyoxolan-3-yl)methylamino]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 113337838 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 4-[[(3-hydroxyoxolan-3-yl)methylamino]methyl]benzene-1,3-diol |
| SMILES | Oc1ccc(CNCC2(O)CCOC2)c(O)c1 |
| InChI | InChI=1S/C12H17NO4/c14-10-2-1-9(11(15)5-10)6-13-7-12(16)3-4-17-8-12/h1-2,5,13-16H,3-4,6-8H2 |
| InChIKey | YXICITBKPKTMDS-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|