C10H18N2O4 — CID 103849591
3-acetamido-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide (PubChem CID 103849591) has the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 3-acetamido-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide.
| Compound Name | 3-acetamido-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide |
|---|---|
| PubChem CID | 103849591 |
| Molecular Formula | C10H18N2O4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 3-acetamido-N-[(3-hydroxyoxolan-3-yl)methyl]propanamide |
| SMILES | CC(=O)NCCC(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C10H18N2O4/c1-8(13)11-4-2-9(14)12-6-10(15)3-5-16-7-10/h15H,2-7H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | YUKHIQTZSJDKII-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |