C9H16FNO3 — CID 126972964
2-fluoro-N-[(3-hydroxyoxolan-3-yl)methyl]-2-methylpropanamide (PubChem CID 126972964) has the molecular formula C9H16FNO3 and a molecular weight of 205.23 g/mol. Its IUPAC name is 2-fluoro-N-[(3-hydroxyoxolan-3-yl)methyl]-2-methylpropanamide.
| Compound Name | 2-fluoro-N-[(3-hydroxyoxolan-3-yl)methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 126972964 |
| Molecular Formula | C9H16FNO3 |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2-fluoro-N-[(3-hydroxyoxolan-3-yl)methyl]-2-methylpropanamide |
| SMILES | CC(C)(F)C(=O)NCC1(O)CCOC1 |
| InChI | InChI=1S/C9H16FNO3/c1-8(2,10)7(12)11-5-9(13)3-4-14-6-9/h13H,3-6H2,1-2H3,(H,11,12) |
| InChIKey | BRAIZGKMEHEXEA-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |