C9H16N2O2S2 — CID 103850413
1-cyano-N-(3-methylsulfanylcyclohexyl)methanesulfonamide (PubChem CID 103850413) has the molecular formula C9H16N2O2S2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 1-cyano-N-(3-methylsulfanylcyclohexyl)methanesulfonamide.
| Compound Name | 1-cyano-N-(3-methylsulfanylcyclohexyl)methanesulfonamide |
|---|---|
| PubChem CID | 103850413 |
| Molecular Formula | C9H16N2O2S2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 1-cyano-N-(3-methylsulfanylcyclohexyl)methanesulfonamide |
| SMILES | CSC1CCCC(NS(=O)(=O)CC#N)C1 |
| InChI | InChI=1S/C9H16N2O2S2/c1-14-9-4-2-3-8(7-9)11-15(12,13)6-5-10/h8-9,11H,2-4,6-7H2,1H3 |
| InChIKey | JYFLVWDNQNCCRS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |