C13H13BrClNO — CID 103852172
(2-bromo-4-chlorophenyl)-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 103852172) has the molecular formula C13H13BrClNO and a molecular weight of 314.61 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl)-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (2-bromo-4-chlorophenyl)-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 103852172 |
| Molecular Formula | C13H13BrClNO |
| Molecular Weight | 314.61 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | (2-bromo-4-chlorophenyl)-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | CC1=CCN(C(=O)c2ccc(Cl)cc2Br)CC1 |
| InChI | InChI=1S/C13H13BrClNO/c1-9-4-6-16(7-5-9)13(17)11-3-2-10(15)8-12(11)14/h2-4,8H,5-7H2,1H3 |
| InChIKey | PWTQOSVVBLRKOX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.61 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|