C13H13BrFNO — CID 115768347
(2-bromo-5-fluorophenyl)-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 115768347) has the molecular formula C13H13BrFNO and a molecular weight of 298.15 g/mol. Its IUPAC name is (2-bromo-5-fluorophenyl)-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | (2-bromo-5-fluorophenyl)-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 115768347 |
| Molecular Formula | C13H13BrFNO |
| Molecular Weight | 298.15 g/mol |
| Exact Mass | 297.02 |
| IUPAC Name | (2-bromo-5-fluorophenyl)-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | CC1=CCN(C(=O)c2cc(F)ccc2Br)CC1 |
| InChI | InChI=1S/C13H13BrFNO/c1-9-4-6-16(7-5-9)13(17)11-8-10(15)2-3-12(11)14/h2-4,8H,5-7H2,1H3 |
| InChIKey | VHSFCDHYHIWZDG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.15 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|