C12H21N5O2 — CID 103857035
2-(carbamoylamino)-4-methyl-N-[1-(1H-pyrazol-4-yl)ethyl]pentanamide (PubChem CID 103857035) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is 2-(carbamoylamino)-4-methyl-N-[1-(1H-pyrazol-4-yl)ethyl]pentanamide.
| Compound Name | 2-(carbamoylamino)-4-methyl-N-[1-(1H-pyrazol-4-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 103857035 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 2-(carbamoylamino)-4-methyl-N-[1-(1H-pyrazol-4-yl)ethyl]pentanamide |
| SMILES | CC(C)CC(NC(N)=O)C(=O)NC(C)c1cn[nH]c1 |
| InChI | InChI=1S/C12H21N5O2/c1-7(2)4-10(17-12(13)19)11(18)16-8(3)9-5-14-15-6-9/h5-8,10H,4H2,1-3H3,(H,14,15)(H,16,18)(H3,13,17,19) |
| InChIKey | QECPXBRWJJCZSC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |