C12H21N5O2 — CID 106212905
(2S)-2-amino-3-methyl-N-[2-oxo-2-[1-(1H-pyrazol-4-yl)ethylamino]ethyl]butanamide (PubChem CID 106212905) has the molecular formula C12H21N5O2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[2-oxo-2-[1-(1H-pyrazol-4-yl)ethylamino]ethyl]butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-[2-oxo-2-[1-(1H-pyrazol-4-yl)ethylamino]ethyl]butanamide |
|---|---|
| PubChem CID | 106212905 |
| Molecular Formula | C12H21N5O2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[2-oxo-2-[1-(1H-pyrazol-4-yl)ethylamino]ethyl]butanamide |
| SMILES | CC(NC(=O)CNC(=O)[C@@H](N)C(C)C)c1cn[nH]c1 |
| InChI | InChI=1S/C12H21N5O2/c1-7(2)11(13)12(19)14-6-10(18)17-8(3)9-4-15-16-5-9/h4-5,7-8,11H,6,13H2,1-3H3,(H,14,19)(H,15,16)(H,17,18)/t8?,11-/m0/s1 |
| InChIKey | KICLYVOKMWERHR-LYNSQETBSA-N |
| XLogP | -0.31 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |