C11H19N5O2 — CID 82962080
(2S)-2-amino-3-methyl-N-[2-oxo-2-(1H-pyrazol-4-ylmethylamino)ethyl]butanamide (PubChem CID 82962080) has the molecular formula C11H19N5O2 and a molecular weight of 253.31 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-N-[2-oxo-2-(1H-pyrazol-4-ylmethylamino)ethyl]butanamide.
| Compound Name | (2S)-2-amino-3-methyl-N-[2-oxo-2-(1H-pyrazol-4-ylmethylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 82962080 |
| Molecular Formula | C11H19N5O2 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (2S)-2-amino-3-methyl-N-[2-oxo-2-(1H-pyrazol-4-ylmethylamino)ethyl]butanamide |
| SMILES | CC(C)[C@H](N)C(=O)NCC(=O)NCc1cn[nH]c1 |
| InChI | InChI=1S/C11H19N5O2/c1-7(2)10(12)11(18)14-6-9(17)13-3-8-4-15-16-5-8/h4-5,7,10H,3,6,12H2,1-2H3,(H,13,17)(H,14,18)(H,15,16)/t10-/m0/s1 |
| InChIKey | GFWOWAUSNGOCQV-JTQLQIEISA-N |
| XLogP | -0.87 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |