C9H15N3O — CID 60735814
2-methyl-N-(1H-pyrazol-4-ylmethyl)butanamide (PubChem CID 60735814) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 2-methyl-N-(1H-pyrazol-4-ylmethyl)butanamide.
| Compound Name | 2-methyl-N-(1H-pyrazol-4-ylmethyl)butanamide |
|---|---|
| PubChem CID | 60735814 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 2-methyl-N-(1H-pyrazol-4-ylmethyl)butanamide |
| SMILES | CCC(C)C(=O)NCc1cn[nH]c1 |
| InChI | InChI=1S/C9H15N3O/c1-3-7(2)9(13)10-4-8-5-11-12-6-8/h5-7H,3-4H2,1-2H3,(H,10,13)(H,11,12) |
| InChIKey | JDWNJZGJRBGSGZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |