C16H13Cl2FN2 — CID 103859975
5-[[1-(3,4-dichlorophenyl)ethylamino]methyl]-2-fluorobenzonitrile (PubChem CID 103859975) has the molecular formula C16H13Cl2FN2 and a molecular weight of 323.20 g/mol. Its IUPAC name is 5-[[1-(3,4-dichlorophenyl)ethylamino]methyl]-2-fluorobenzonitrile.
| Compound Name | 5-[[1-(3,4-dichlorophenyl)ethylamino]methyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 103859975 |
| Molecular Formula | C16H13Cl2FN2 |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 5-[[1-(3,4-dichlorophenyl)ethylamino]methyl]-2-fluorobenzonitrile |
| SMILES | CC(NCc1ccc(F)c(C#N)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2FN2/c1-10(12-3-4-14(17)15(18)7-12)21-9-11-2-5-16(19)13(6-11)8-20/h2-7,10,21H,9H2,1H3 |
| InChIKey | ZOXCOUUJPGSBBR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |