C12H20N4O4 — CID 103861971
N-(5-hydroxy-4-methylpentyl)-3-(4-nitroimidazol-1-yl)propanamide (PubChem CID 103861971) has the molecular formula C12H20N4O4 and a molecular weight of 284.32 g/mol. Its IUPAC name is N-(5-hydroxy-4-methylpentyl)-3-(4-nitroimidazol-1-yl)propanamide.
| Compound Name | N-(5-hydroxy-4-methylpentyl)-3-(4-nitroimidazol-1-yl)propanamide |
|---|---|
| PubChem CID | 103861971 |
| Molecular Formula | C12H20N4O4 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | N-(5-hydroxy-4-methylpentyl)-3-(4-nitroimidazol-1-yl)propanamide |
| SMILES | CC(CO)CCCNC(=O)CCn1cnc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H20N4O4/c1-10(8-17)3-2-5-13-12(18)4-6-15-7-11(14-9-15)16(19)20/h7,9-10,17H,2-6,8H2,1H3,(H,13,18) |
| InChIKey | WUOWDZNLSKJDLV-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|