C11H16N4O5S — CID 43170228
4-methylsulfanyl-2-[3-(4-nitroimidazol-1-yl)propanoylamino]butanoic acid (PubChem CID 43170228) has the molecular formula C11H16N4O5S and a molecular weight of 316.34 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[3-(4-nitroimidazol-1-yl)propanoylamino]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[3-(4-nitroimidazol-1-yl)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 43170228 |
| Molecular Formula | C11H16N4O5S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 4-methylsulfanyl-2-[3-(4-nitroimidazol-1-yl)propanoylamino]butanoic acid |
| SMILES | CSCCC(NC(=O)CCn1cnc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C11H16N4O5S/c1-21-5-3-8(11(17)18)13-10(16)2-4-14-6-9(12-7-14)15(19)20/h6-8H,2-5H2,1H3,(H,13,16)(H,17,18) |
| InChIKey | IWLYCYLCQGFUJG-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|