C10H10N6O5 — CID 64527671
3-[3-(4-nitroimidazol-1-yl)propanoylamino]-1H-pyrazole-5-carboxylic acid (PubChem CID 64527671) has the molecular formula C10H10N6O5 and a molecular weight of 294.23 g/mol. Its IUPAC name is 3-[3-(4-nitroimidazol-1-yl)propanoylamino]-1H-pyrazole-5-carboxylic acid.
| Compound Name | 3-[3-(4-nitroimidazol-1-yl)propanoylamino]-1H-pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 64527671 |
| Molecular Formula | C10H10N6O5 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[3-(4-nitroimidazol-1-yl)propanoylamino]-1H-pyrazole-5-carboxylic acid |
| SMILES | O=C(CCn1cnc([N+](=O)[O-])c1)Nc1cc(C(=O)O)[nH]n1 |
| InChI | InChI=1S/C10H10N6O5/c17-9(12-7-3-6(10(18)19)13-14-7)1-2-15-4-8(11-5-15)16(20)21/h3-5H,1-2H2,(H,18,19)(H2,12,13,14,17) |
| InChIKey | BRPNHCKEHHTBJW-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 156.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|