C12H12Cl2N4O — CID 103862411
2,6-dichloro-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyridine-3-carboxamide (PubChem CID 103862411) has the molecular formula C12H12Cl2N4O and a molecular weight of 299.16 g/mol. Its IUPAC name is 2,6-dichloro-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyridine-3-carboxamide.
| Compound Name | 2,6-dichloro-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 103862411 |
| Molecular Formula | C12H12Cl2N4O |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 2,6-dichloro-N-[(1,5-dimethylpyrazol-4-yl)methyl]pyridine-3-carboxamide |
| SMILES | Cc1c(CNC(=O)c2ccc(Cl)nc2Cl)cnn1C |
| InChI | InChI=1S/C12H12Cl2N4O/c1-7-8(6-16-18(7)2)5-15-12(19)9-3-4-10(13)17-11(9)14/h3-4,6H,5H2,1-2H3,(H,15,19) |
| InChIKey | MHIAZUCPJPGKPV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|