C12H12F2N4O — CID 103187314
N-[(1,5-dimethylpyrazol-4-yl)methyl]-2,3-difluoropyridine-4-carboxamide (PubChem CID 103187314) has the molecular formula C12H12F2N4O and a molecular weight of 266.25 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-2,3-difluoropyridine-4-carboxamide.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-2,3-difluoropyridine-4-carboxamide |
|---|---|
| PubChem CID | 103187314 |
| Molecular Formula | C12H12F2N4O |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-2,3-difluoropyridine-4-carboxamide |
| SMILES | Cc1c(CNC(=O)c2ccnc(F)c2F)cnn1C |
| InChI | InChI=1S/C12H12F2N4O/c1-7-8(6-17-18(7)2)5-16-12(19)9-3-4-15-11(14)10(9)13/h3-4,6H,5H2,1-2H3,(H,16,19) |
| InChIKey | LCECFZMKGZDCBP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|