C13H16FN5O — CID 106040117
N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-2-hydrazinylbenzamide (PubChem CID 106040117) has the molecular formula C13H16FN5O and a molecular weight of 277.30 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-2-hydrazinylbenzamide.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-2-hydrazinylbenzamide |
|---|---|
| PubChem CID | 106040117 |
| Molecular Formula | C13H16FN5O |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-3-fluoro-2-hydrazinylbenzamide |
| SMILES | Cc1c(CNC(=O)c2cccc(F)c2NN)cnn1C |
| InChI | InChI=1S/C13H16FN5O/c1-8-9(7-17-19(8)2)6-16-13(20)10-4-3-5-11(14)12(10)18-15/h3-5,7,18H,6,15H2,1-2H3,(H,16,20) |
| InChIKey | HBGXJOJTQHJHOH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|