C14H16FN3O2 — CID 103860981
N-[(1,5-dimethylpyrazol-4-yl)methyl]-2-fluoro-4-methoxybenzamide (PubChem CID 103860981) has the molecular formula C14H16FN3O2 and a molecular weight of 277.30 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-4-yl)methyl]-2-fluoro-4-methoxybenzamide.
| Compound Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-2-fluoro-4-methoxybenzamide |
|---|---|
| PubChem CID | 103860981 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-4-yl)methyl]-2-fluoro-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2cnn(C)c2C)c(F)c1 |
| InChI | InChI=1S/C14H16FN3O2/c1-9-10(8-17-18(9)2)7-16-14(19)12-5-4-11(20-3)6-13(12)15/h4-6,8H,7H2,1-3H3,(H,16,19) |
| InChIKey | QOCZVLAXUWBDSW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |