C28H26N2O4 — CID 1038625
[2-methoxy-4-[(6S,9R)-7-oxo-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]phenyl] acetate (PubChem CID 1038625) has the molecular formula C28H26N2O4 and a molecular weight of 454.53 g/mol. Its IUPAC name is [2-methoxy-4-[(6S,9R)-7-oxo-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]phenyl] acetate.
| Compound Name | [2-methoxy-4-[(6S,9R)-7-oxo-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]phenyl] acetate |
|---|---|
| PubChem CID | 1038625 |
| Molecular Formula | C28H26N2O4 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | [2-methoxy-4-[(6S,9R)-7-oxo-9-phenyl-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]phenyl] acetate |
| SMILES | COc1cc([C@@H]2Nc3ccccc3NC3=C2C(=O)C[C@H](c2ccccc2)C3)ccc1OC(C)=O |
| InChI | InChI=1S/C28H26N2O4/c1-17(31)34-25-13-12-19(16-26(25)33-2)28-27-23(29-21-10-6-7-11-22(21)30-28)14-20(15-24(27)32)18-8-4-3-5-9-18/h3-13,16,20,28-30H,14-15H2,1-2H3/t20-,28+/m1/s1 |
| InChIKey | SXBAXNMJXXZIDI-NGOKVRLYSA-N |
| XLogP | 5.60 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|