C28H25FN2O4 — CID 17063756
[4-[9-(4-fluorophenyl)-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]-2-methoxyphenyl] acetate (PubChem CID 17063756) has the molecular formula C28H25FN2O4 and a molecular weight of 472.52 g/mol. Its IUPAC name is [4-[9-(4-fluorophenyl)-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]-2-methoxyphenyl] acetate.
| Compound Name | [4-[9-(4-fluorophenyl)-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 17063756 |
| Molecular Formula | C28H25FN2O4 |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | [4-[9-(4-fluorophenyl)-7-oxo-5,6,8,9,10,11-hexahydrobenzo[b][1,4]benzodiazepin-6-yl]-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C2Nc3ccccc3NC3=C2C(=O)CC(c2ccc(F)cc2)C3)ccc1OC(C)=O |
| InChI | InChI=1S/C28H25FN2O4/c1-16(32)35-25-12-9-18(15-26(25)34-2)28-27-23(30-21-5-3-4-6-22(21)31-28)13-19(14-24(27)33)17-7-10-20(29)11-8-17/h3-12,15,19,28,30-31H,13-14H2,1-2H3 |
| InChIKey | CTCDCNYJWZWVMI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|