C13H14N2O5S — CID 103862612
4-(4-cyano-2-methylphenyl)sulfonylmorpholine-2-carboxylic acid (PubChem CID 103862612) has the molecular formula C13H14N2O5S and a molecular weight of 310.33 g/mol. Its IUPAC name is 4-(4-cyano-2-methylphenyl)sulfonylmorpholine-2-carboxylic acid.
| Compound Name | 4-(4-cyano-2-methylphenyl)sulfonylmorpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 103862612 |
| Molecular Formula | C13H14N2O5S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 4-(4-cyano-2-methylphenyl)sulfonylmorpholine-2-carboxylic acid |
| SMILES | Cc1cc(C#N)ccc1S(=O)(=O)N1CCOC(C(=O)O)C1 |
| InChI | InChI=1S/C13H14N2O5S/c1-9-6-10(7-14)2-3-12(9)21(18,19)15-4-5-20-11(8-15)13(16)17/h2-3,6,11H,4-5,8H2,1H3,(H,16,17) |
| InChIKey | RGYSNLUURXUOMA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |