C14H18N2O2S — CID 103698242
4-(3,3-dimethylpyrrolidin-1-yl)sulfonyl-3-methylbenzonitrile (PubChem CID 103698242) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-(3,3-dimethylpyrrolidin-1-yl)sulfonyl-3-methylbenzonitrile.
| Compound Name | 4-(3,3-dimethylpyrrolidin-1-yl)sulfonyl-3-methylbenzonitrile |
|---|---|
| PubChem CID | 103698242 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 4-(3,3-dimethylpyrrolidin-1-yl)sulfonyl-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1S(=O)(=O)N1CCC(C)(C)C1 |
| InChI | InChI=1S/C14H18N2O2S/c1-11-8-12(9-15)4-5-13(11)19(17,18)16-7-6-14(2,3)10-16/h4-5,8H,6-7,10H2,1-3H3 |
| InChIKey | QSJSHDADSOSXKS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |