C21H28N2O6 — CID 10386499
[3-[(2-hydroxy-3-naphthalen-1-yloxypropyl)-propan-2-ylamino]-2,2-dimethyl-3-oxopropyl] nitrate (PubChem CID 10386499) has the molecular formula C21H28N2O6 and a molecular weight of 404.46 g/mol. Its IUPAC name is [3-[(2-hydroxy-3-naphthalen-1-yloxypropyl)-propan-2-ylamino]-2,2-dimethyl-3-oxopropyl] nitrate.
| Compound Name | [3-[(2-hydroxy-3-naphthalen-1-yloxypropyl)-propan-2-ylamino]-2,2-dimethyl-3-oxopropyl] nitrate |
|---|---|
| PubChem CID | 10386499 |
| Molecular Formula | C21H28N2O6 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | [3-[(2-hydroxy-3-naphthalen-1-yloxypropyl)-propan-2-ylamino]-2,2-dimethyl-3-oxopropyl] nitrate |
| SMILES | CC(C)N(CC(O)COc1cccc2ccccc12)C(=O)C(C)(C)CO[N+](=O)[O-] |
| InChI | InChI=1S/C21H28N2O6/c1-15(2)22(20(25)21(3,4)14-29-23(26)27)12-17(24)13-28-19-11-7-9-16-8-5-6-10-18(16)19/h5-11,15,17,24H,12-14H2,1-4H3 |
| InChIKey | PWMBILZQQGSMGG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|