About Dexpropranolol
Dexpropranolol (PubChem CID 21138) has the molecular formula C16H21NO2
and a molecular weight of 259.34 g/mol. Its IUPAC name is (2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol.
Molecular Properties
| Compound Name | Dexpropranolol |
| PubChem CID | 21138 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CC(C)NC[C@H](COC1=CC=CC2=CC=CC=C21)O |
| InChI | InChI=1S/C16H21NO2/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,14,17-18H,10-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | AQHHHDLHHXJYJD-CQSZACIVSA-N |
| XLogP | 3.00 |
| TPSA | 41.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | 257 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Dexpropranolol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dexpropranolol?
The IUPAC name of Dexpropranolol (CID 21138) is (2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol.
What is the SMILES notation for Dexpropranolol?
The canonical SMILES for Dexpropranolol is CC(C)NC[C@H](COC1=CC=CC2=CC=CC=C21)O.
What is the InChIKey of Dexpropranolol?
The InChIKey is AQHHHDLHHXJYJD-CQSZACIVSA-N. The full InChI is InChI=1S/C16H21NO2/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16/h3-9,12,14,17-18H,10-11H2,1-2H3/t14-/m1/s1.
What are the key properties of Dexpropranolol?
Dexpropranolol has a molecular weight of 259.34 g/mol, XLogP of 3.00, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Dexpropranolol is sourced from PubChem (CID 21138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).