About Dexpropranolol Hydrochloride
Dexpropranolol Hydrochloride (PubChem CID 66366) has the molecular formula C16H22ClNO2
and a molecular weight of 295.80 g/mol. Its IUPAC name is (2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride.
Molecular Properties
| Compound Name | Dexpropranolol Hydrochloride |
| PubChem CID | 66366 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride |
| SMILES | CC(C)NC[C@H](COC1=CC=CC2=CC=CC=C21)O.Cl |
| InChI | InChI=1S/C16H21NO2.ClH/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16;/h3-9,12,14,17-18H,10-11H2,1-2H3;1H/t14-;/m1./s1 |
| InChIKey | ZMRUPTIKESYGQW-PFEQFJNWSA-N |
| XLogP | — |
| TPSA | 41.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | 257 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Dexpropranolol Hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Dexpropranolol Hydrochloride?
The IUPAC name of Dexpropranolol Hydrochloride (CID 66366) is (2R)-1-naphthalen-1-yloxy-3-(propan-2-ylamino)propan-2-ol;hydrochloride.
What is the SMILES notation for Dexpropranolol Hydrochloride?
The canonical SMILES for Dexpropranolol Hydrochloride is CC(C)NC[C@H](COC1=CC=CC2=CC=CC=C21)O.Cl.
What is the InChIKey of Dexpropranolol Hydrochloride?
The InChIKey is ZMRUPTIKESYGQW-PFEQFJNWSA-N. The full InChI is InChI=1S/C16H21NO2.ClH/c1-12(2)17-10-14(18)11-19-16-9-5-7-13-6-3-4-8-15(13)16;/h3-9,12,14,17-18H,10-11H2,1-2H3;1H/t14-;/m1./s1.
What are the key properties of Dexpropranolol Hydrochloride?
Dexpropranolol Hydrochloride has a molecular weight of 295.80 g/mol, XLogP of not available, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Dexpropranolol Hydrochloride is sourced from PubChem (CID 66366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).