About (+-)-Bunolol
(+-)-Bunolol (PubChem CID 3914) has the molecular formula C17H25NO3
and a molecular weight of 291.40 g/mol. Its IUPAC name is 5-[3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | (+-)-Bunolol |
| PubChem CID | 3914 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 5-[3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(C)(C)NCC(COC1=CC=CC2=C1CCCC2=O)O |
| InChI | InChI=1S/C17H25NO3/c1-17(2,3)18-10-12(19)11-21-16-9-5-6-13-14(16)7-4-8-15(13)20/h5-6,9,12,18-19H,4,7-8,10-11H2,1-3H3 |
| InChIKey | IXHBTMCLRNMKHZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | 350 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (+-)-Bunolol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (+-)-Bunolol?
The IUPAC name of (+-)-Bunolol (CID 3914) is 5-[3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for (+-)-Bunolol?
The canonical SMILES for (+-)-Bunolol is CC(C)(C)NCC(COC1=CC=CC2=C1CCCC2=O)O.
What is the InChIKey of (+-)-Bunolol?
The InChIKey is IXHBTMCLRNMKHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO3/c1-17(2,3)18-10-12(19)11-21-16-9-5-6-13-14(16)7-4-8-15(13)20/h5-6,9,12,18-19H,4,7-8,10-11H2,1-3H3.
What are the key properties of (+-)-Bunolol?
(+-)-Bunolol has a molecular weight of 291.40 g/mol, XLogP of 2.40, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (+-)-Bunolol is sourced from PubChem (CID 3914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).