About Levobunolol
Levobunolol (PubChem CID 39468) has the molecular formula C17H25NO3
and a molecular weight of 291.40 g/mol. Its IUPAC name is 5-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | Levobunolol |
| PubChem CID | 39468 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 5-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CC(C)(C)NC[C@@H](COC1=CC=CC2=C1CCCC2=O)O |
| InChI | InChI=1S/C17H25NO3/c1-17(2,3)18-10-12(19)11-21-16-9-5-6-13-14(16)7-4-8-15(13)20/h5-6,9,12,18-19H,4,7-8,10-11H2,1-3H3/t12-/m0/s1 |
| InChIKey | IXHBTMCLRNMKHZ-LBPRGKRZSA-N |
| XLogP | 2.40 |
| TPSA | 58.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | 350 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze Levobunolol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Levobunolol?
The IUPAC name of Levobunolol (CID 39468) is 5-[(2S)-3-(tert-butylamino)-2-hydroxypropoxy]-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for Levobunolol?
The canonical SMILES for Levobunolol is CC(C)(C)NC[C@@H](COC1=CC=CC2=C1CCCC2=O)O.
What is the InChIKey of Levobunolol?
The InChIKey is IXHBTMCLRNMKHZ-LBPRGKRZSA-N. The full InChI is InChI=1S/C17H25NO3/c1-17(2,3)18-10-12(19)11-21-16-9-5-6-13-14(16)7-4-8-15(13)20/h5-6,9,12,18-19H,4,7-8,10-11H2,1-3H3/t12-/m0/s1.
What are the key properties of Levobunolol?
Levobunolol has a molecular weight of 291.40 g/mol, XLogP of 2.40, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for Levobunolol is sourced from PubChem (CID 39468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).