C23H21ClN4O — CID 10386529
3-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-6-(2-pyrrolidin-1-ylethoxy)pyridazine (PubChem CID 10386529) has the molecular formula C23H21ClN4O and a molecular weight of 404.90 g/mol. Its IUPAC name is 3-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-6-(2-pyrrolidin-1-ylethoxy)pyridazine.
| Compound Name | 3-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-6-(2-pyrrolidin-1-ylethoxy)pyridazine |
|---|---|
| PubChem CID | 10386529 |
| Molecular Formula | C23H21ClN4O |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 3-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]-6-(2-pyrrolidin-1-ylethoxy)pyridazine |
| SMILES | Clc1ccc(-c2ccc(C#Cc3ccc(OCCN4CCCC4)nn3)nc2)cc1 |
| InChI | InChI=1S/C23H21ClN4O/c24-20-6-3-18(4-7-20)19-5-8-21(25-17-19)9-10-22-11-12-23(27-26-22)29-16-15-28-13-1-2-14-28/h3-8,11-12,17H,1-2,13-16H2 |
| InChIKey | ONORAHZIFZWHKB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|