C26H26ClN3O — CID 59835853
1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]-4-methylpiperazine (PubChem CID 59835853) has the molecular formula C26H26ClN3O and a molecular weight of 431.97 g/mol. Its IUPAC name is 1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]-4-methylpiperazine.
| Compound Name | 1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 59835853 |
| Molecular Formula | C26H26ClN3O |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 1-[2-[4-[2-[5-(4-chlorophenyl)-2-pyridinyl]ethynyl]phenoxy]ethyl]-4-methylpiperazine |
| SMILES | CN1CCN(CCOc2ccc(C#Cc3ccc(-c4ccc(Cl)cc4)cn3)cc2)CC1 |
| InChI | InChI=1S/C26H26ClN3O/c1-29-14-16-30(17-15-29)18-19-31-26-12-3-21(4-13-26)2-10-25-11-7-23(20-28-25)22-5-8-24(27)9-6-22/h3-9,11-13,20H,14-19H2,1H3 |
| InChIKey | ZYBGQXVZZISJNT-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|